C19H19ClN2O3S2 — CID 90961820
(3-chloro-1-benzothiophen-2-yl)-[2-[hydroxy-(hydroxyamino)methyl]-7,7-dimethyl-4,6-dihydrothieno[3,2-c]pyridin-5-yl]methanone (PubChem CID 90961820) has the molecular formula C19H19ClN2O3S2 and a molecular weight of 422.96 g/mol. Its IUPAC name is (3-chloro-1-benzothiophen-2-yl)-[2-[hydroxy-(hydroxyamino)methyl]-7,7-dimethyl-4,6-dihydrothieno[3,2-c]pyridin-5-yl]methanone.
| Compound Name | (3-chloro-1-benzothiophen-2-yl)-[2-[hydroxy-(hydroxyamino)methyl]-7,7-dimethyl-4,6-dihydrothieno[3,2-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 90961820 |
| Molecular Formula | C19H19ClN2O3S2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | (3-chloro-1-benzothiophen-2-yl)-[2-[hydroxy-(hydroxyamino)methyl]-7,7-dimethyl-4,6-dihydrothieno[3,2-c]pyridin-5-yl]methanone |
| SMILES | CC1(C)CN(C(=O)c2sc3ccccc3c2Cl)Cc2cc(C(O)NO)sc21 |
| InChI | InChI=1S/C19H19ClN2O3S2/c1-19(2)9-22(8-10-7-13(17(23)21-25)27-16(10)19)18(24)15-14(20)11-5-3-4-6-12(11)26-15/h3-7,17,21,23,25H,8-9H2,1-2H3 |
| InChIKey | ONVUOXDVCFOSLU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|