C28H30N4O7 — CID 90961849
5-O-ethyl 1-O-(piperazine-1-carbonyl) 2-[[4-(furan-3-yl)-6-phenylpyridine-2-carbonyl]amino]pentanedioate (PubChem CID 90961849) has the molecular formula C28H30N4O7 and a molecular weight of 534.57 g/mol. Its IUPAC name is 5-O-ethyl 1-O-(piperazine-1-carbonyl) 2-[[4-(furan-3-yl)-6-phenylpyridine-2-carbonyl]amino]pentanedioate.
| Compound Name | 5-O-ethyl 1-O-(piperazine-1-carbonyl) 2-[[4-(furan-3-yl)-6-phenylpyridine-2-carbonyl]amino]pentanedioate |
|---|---|
| PubChem CID | 90961849 |
| Molecular Formula | C28H30N4O7 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 5-O-ethyl 1-O-(piperazine-1-carbonyl) 2-[[4-(furan-3-yl)-6-phenylpyridine-2-carbonyl]amino]pentanedioate |
| SMILES | CCOC(=O)CCC(NC(=O)c1cc(-c2ccoc2)cc(-c2ccccc2)n1)C(=O)OC(=O)N1CCNCC1 |
| InChI | InChI=1S/C28H30N4O7/c1-2-38-25(33)9-8-22(27(35)39-28(36)32-13-11-29-12-14-32)31-26(34)24-17-21(20-10-15-37-18-20)16-23(30-24)19-6-4-3-5-7-19/h3-7,10,15-18,22,29H,2,8-9,11-14H2,1H3,(H,31,34) |
| InChIKey | KEBMYWKLSXRHTA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 140.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|