C12H26NO2S+ — CID 90961884
2,2,3,4,4-pentamethyl-3-methyl-5-methylsulfonylpentan-1-amine (PubChem CID 90961884) has the molecular formula C12H26NO2S+ and a molecular weight of 248.41 g/mol. Its IUPAC name is 2,2,3,4,4-pentamethyl-3-methyl-5-methylsulfonylpentan-1-amine.
| Compound Name | 2,2,3,4,4-pentamethyl-3-methyl-5-methylsulfonylpentan-1-amine |
|---|---|
| PubChem CID | 90961884 |
| Molecular Formula | C12H26NO2S+ |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 2,2,3,4,4-pentamethyl-3-methyl-5-methylsulfonylpentan-1-amine |
| SMILES | [CH2+]C(C)(C(C)(C)CN)C(C)(C)CS(C)(=O)=O |
| InChI | InChI=1S/C12H26NO2S/c1-10(2,8-13)12(5,6)11(3,4)9-16(7,14)15/h5,8-9,13H2,1-4,6-7H3/q+1 |
| InChIKey | NYVJLHHODHJFAU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|