C14H10N6 — CID 90962352
3-(4,6-diamino-1,3,5-triazin-2-yl)naphthalene-2-carbonitrile (PubChem CID 90962352) has the molecular formula C14H10N6 and a molecular weight of 262.28 g/mol. Its IUPAC name is 3-(4,6-diamino-1,3,5-triazin-2-yl)naphthalene-2-carbonitrile.
| Compound Name | 3-(4,6-diamino-1,3,5-triazin-2-yl)naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 90962352 |
| Molecular Formula | C14H10N6 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 3-(4,6-diamino-1,3,5-triazin-2-yl)naphthalene-2-carbonitrile |
| SMILES | N#Cc1cc2ccccc2cc1-c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C14H10N6/c15-7-10-5-8-3-1-2-4-9(8)6-11(10)12-18-13(16)20-14(17)19-12/h1-6H,(H4,16,17,18,19,20) |
| InChIKey | DLZJSUGWNUSCIM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |