C6H4F4 — CID 90962434
1,2,3,4-tetrafluorocyclohexa-1,4-diene (PubChem CID 90962434) has the molecular formula C6H4F4 and a molecular weight of 152.09 g/mol. Its IUPAC name is 1,2,3,4-tetrafluorocyclohexa-1,4-diene.
| Compound Name | 1,2,3,4-tetrafluorocyclohexa-1,4-diene |
|---|---|
| PubChem CID | 90962434 |
| Molecular Formula | C6H4F4 |
| Molecular Weight | 152.09 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 1,2,3,4-tetrafluorocyclohexa-1,4-diene |
| SMILES | FC1=CCC(F)=C(F)C1F |
| InChI | InChI=1S/C6H4F4/c7-3-1-2-4(8)6(10)5(3)9/h1,5H,2H2 |
| InChIKey | ZBUFSKYIUMCCCN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.09 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |