C22H23ClN4O4 — CID 90962600
1-[(2R)-2-[1-[4-(3-chloro-4-hydroxyanilino)quinazolin-5-yl]oxyethyl]pyrrolidin-1-yl]-2-hydroxyethanone (PubChem CID 90962600) has the molecular formula C22H23ClN4O4 and a molecular weight of 442.90 g/mol. Its IUPAC name is 1-[(2R)-2-[1-[4-(3-chloro-4-hydroxyanilino)quinazolin-5-yl]oxyethyl]pyrrolidin-1-yl]-2-hydroxyethanone.
| Compound Name | 1-[(2R)-2-[1-[4-(3-chloro-4-hydroxyanilino)quinazolin-5-yl]oxyethyl]pyrrolidin-1-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 90962600 |
| Molecular Formula | C22H23ClN4O4 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-[(2R)-2-[1-[4-(3-chloro-4-hydroxyanilino)quinazolin-5-yl]oxyethyl]pyrrolidin-1-yl]-2-hydroxyethanone |
| SMILES | CC(Oc1cccc2ncnc(Nc3ccc(O)c(Cl)c3)c12)[C@H]1CCCN1C(=O)CO |
| InChI | InChI=1S/C22H23ClN4O4/c1-13(17-5-3-9-27(17)20(30)11-28)31-19-6-2-4-16-21(19)22(25-12-24-16)26-14-7-8-18(29)15(23)10-14/h2,4,6-8,10,12-13,17,28-29H,3,5,9,11H2,1H3,(H,24,25,26)/t13?,17-/m1/s1 |
| InChIKey | OWSWKLDSQCABAM-LRHAYUFXSA-N |
| XLogP | 3.48 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|