C24H44N4O8 — CID 90963090
N-[2-[2-[2-[[2-amino-2-(3-methoxy-3-methylbutoxy)propanoyl]amino]ethoxy]ethoxy]ethyl]-4-(2,5-dihydroxy-3-methylpyrrol-1-yl)butanamide (PubChem CID 90963090) has the molecular formula C24H44N4O8 and a molecular weight of 516.64 g/mol. Its IUPAC name is N-[2-[2-[2-[[2-amino-2-(3-methoxy-3-methylbutoxy)propanoyl]amino]ethoxy]ethoxy]ethyl]-4-(2,5-dihydroxy-3-methylpyrrol-1-yl)butanamide.
| Compound Name | N-[2-[2-[2-[[2-amino-2-(3-methoxy-3-methylbutoxy)propanoyl]amino]ethoxy]ethoxy]ethyl]-4-(2,5-dihydroxy-3-methylpyrrol-1-yl)butanamide |
|---|---|
| PubChem CID | 90963090 |
| Molecular Formula | C24H44N4O8 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | N-[2-[2-[2-[[2-amino-2-(3-methoxy-3-methylbutoxy)propanoyl]amino]ethoxy]ethoxy]ethyl]-4-(2,5-dihydroxy-3-methylpyrrol-1-yl)butanamide |
| SMILES | COC(C)(C)CCOC(C)(N)C(=O)NCCOCCOCCNC(=O)CCCn1c(O)cc(C)c1O |
| InChI | InChI=1S/C24H44N4O8/c1-18-17-20(30)28(21(18)31)11-6-7-19(29)26-9-13-34-15-16-35-14-10-27-22(32)24(4,25)36-12-8-23(2,3)33-5/h17,30-31H,6-16,25H2,1-5H3,(H,26,29)(H,27,32) |
| InChIKey | WLUCYXVZEADUTQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 166.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|