About 3,6-dimethyl-4,7-dihydro-1H-purin-2-one
3,6-dimethyl-4,7-dihydro-1H-purin-2-one (PubChem CID 90963105) has the molecular formula C7H10N4O
and a molecular weight of 166.18 g/mol. Its IUPAC name is 3,6-dimethyl-4,7-dihydro-1H-purin-2-one.
Molecular Properties
| Compound Name | 3,6-dimethyl-4,7-dihydro-1H-purin-2-one |
| PubChem CID | 90963105 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 3,6-dimethyl-4,7-dihydro-1H-purin-2-one |
| SMILES | CC1=C2NC=NC2N(C)C(=O)N1 |
| InChI | InChI=1S/C7H10N4O/c1-4-5-6(9-3-8-5)11(2)7(12)10-4/h3,6H,1-2H3,(H,8,9)(H,10,12) |
| InChIKey | AHSKJZMWMLULOV-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,6-dimethyl-4,7-dihydro-1H-purin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-4,7-dihydro-1H-purin-2-one?
The IUPAC name of 3,6-dimethyl-4,7-dihydro-1H-purin-2-one (CID 90963105) is 3,6-dimethyl-4,7-dihydro-1H-purin-2-one.
What is the SMILES notation for 3,6-dimethyl-4,7-dihydro-1H-purin-2-one?
The canonical SMILES for 3,6-dimethyl-4,7-dihydro-1H-purin-2-one is CC1=C2NC=NC2N(C)C(=O)N1.
What is the InChIKey of 3,6-dimethyl-4,7-dihydro-1H-purin-2-one?
The InChIKey is AHSKJZMWMLULOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O/c1-4-5-6(9-3-8-5)11(2)7(12)10-4/h3,6H,1-2H3,(H,8,9)(H,10,12).
What are the key properties of 3,6-dimethyl-4,7-dihydro-1H-purin-2-one?
3,6-dimethyl-4,7-dihydro-1H-purin-2-one has a molecular weight of 166.18 g/mol, XLogP of -0.17, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-4,7-dihydro-1H-purin-2-one is sourced from PubChem (CID 90963105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).