C19H32N4O3 — CID 90963173
N-(2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl)-3-methyl-2-(methylamino)butanamide (PubChem CID 90963173) has the molecular formula C19H32N4O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-(2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl)-3-methyl-2-(methylamino)butanamide.
| Compound Name | N-(2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl)-3-methyl-2-(methylamino)butanamide |
|---|---|
| PubChem CID | 90963173 |
| Molecular Formula | C19H32N4O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | N-(2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl)-3-methyl-2-(methylamino)butanamide |
| SMILES | CNC(C(=O)NC1C=CCCNC(=O)C=CC(C(C)C)NC1=O)C(C)C |
| InChI | InChI=1S/C19H32N4O3/c1-12(2)14-9-10-16(24)21-11-7-6-8-15(18(25)22-14)23-19(26)17(20-5)13(3)4/h6,8-10,12-15,17,20H,7,11H2,1-5H3,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | KBSALKWEGPFJMM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|