C23H30N4O5 — CID 90963454
[3-amino-4-[N-[[cyclohexyl(furan-2-carbonyl)amino]methyl]anilino]-4-oxobutyl]carbamic acid (PubChem CID 90963454) has the molecular formula C23H30N4O5 and a molecular weight of 442.52 g/mol. Its IUPAC name is [3-amino-4-[N-[[cyclohexyl(furan-2-carbonyl)amino]methyl]anilino]-4-oxobutyl]carbamic acid.
| Compound Name | [3-amino-4-[N-[[cyclohexyl(furan-2-carbonyl)amino]methyl]anilino]-4-oxobutyl]carbamic acid |
|---|---|
| PubChem CID | 90963454 |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | [3-amino-4-[N-[[cyclohexyl(furan-2-carbonyl)amino]methyl]anilino]-4-oxobutyl]carbamic acid |
| SMILES | NC(CCNC(=O)O)C(=O)N(CN(C(=O)c1ccco1)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H30N4O5/c24-19(13-14-25-23(30)31)21(28)26(17-8-3-1-4-9-17)16-27(18-10-5-2-6-11-18)22(29)20-12-7-15-32-20/h1,3-4,7-9,12,15,18-19,25H,2,5-6,10-11,13-14,16,24H2,(H,30,31) |
| InChIKey | NCXQAOVJTMVRNF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|