C10H19O+ — CID 90963653
3,3,4,5-tetramethylhexan-2-one (PubChem CID 90963653) has the molecular formula C10H19O+ and a molecular weight of 155.26 g/mol. Its IUPAC name is 3,3,4,5-tetramethylhexan-2-one.
| Compound Name | 3,3,4,5-tetramethylhexan-2-one |
|---|---|
| PubChem CID | 90963653 |
| Molecular Formula | C10H19O+ |
| Molecular Weight | 155.26 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 3,3,4,5-tetramethylhexan-2-one |
| SMILES | [CH2+]C(=O)C(C)(C)C(C)C(C)C |
| InChI | InChI=1S/C10H19O/c1-7(2)8(3)10(5,6)9(4)11/h7-8H,4H2,1-3,5-6H3/q+1 |
| InChIKey | VSKSDGMACIYACB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|