C17H21ClFN5OSi — CID 90963759
3-(2-chloro-5-fluoropyrimidin-4-yl)-1-(2-trimethylsilylethoxymethyl)indazol-4-amine (PubChem CID 90963759) has the molecular formula C17H21ClFN5OSi and a molecular weight of 393.93 g/mol. Its IUPAC name is 3-(2-chloro-5-fluoropyrimidin-4-yl)-1-(2-trimethylsilylethoxymethyl)indazol-4-amine.
| Compound Name | 3-(2-chloro-5-fluoropyrimidin-4-yl)-1-(2-trimethylsilylethoxymethyl)indazol-4-amine |
|---|---|
| PubChem CID | 90963759 |
| Molecular Formula | C17H21ClFN5OSi |
| Molecular Weight | 393.93 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 3-(2-chloro-5-fluoropyrimidin-4-yl)-1-(2-trimethylsilylethoxymethyl)indazol-4-amine |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2nc(Cl)ncc2F)c2c(N)cccc21 |
| InChI | InChI=1S/C17H21ClFN5OSi/c1-26(2,3)8-7-25-10-24-13-6-4-5-12(20)14(13)16(23-24)15-11(19)9-21-17(18)22-15/h4-6,9H,7-8,10,20H2,1-3H3 |
| InChIKey | POCFEKPCZIQCNT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.93 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|