About methyl 2-amino-2,3-dihydropyridine-5-carboxylate
methyl 2-amino-2,3-dihydropyridine-5-carboxylate (PubChem CID 90963851) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is methyl 2-amino-2,3-dihydropyridine-5-carboxylate.
Molecular Properties
| Compound Name | methyl 2-amino-2,3-dihydropyridine-5-carboxylate |
| PubChem CID | 90963851 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | methyl 2-amino-2,3-dihydropyridine-5-carboxylate |
| SMILES | COC(=O)C1=CCC(N)N=C1 |
| InChI | InChI=1S/C7H10N2O2/c1-11-7(10)5-2-3-6(8)9-4-5/h2,4,6H,3,8H2,1H3 |
| InChIKey | YMCRURJEODCDCZ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-amino-2,3-dihydropyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-2,3-dihydropyridine-5-carboxylate?
The IUPAC name of methyl 2-amino-2,3-dihydropyridine-5-carboxylate (CID 90963851) is methyl 2-amino-2,3-dihydropyridine-5-carboxylate.
What is the SMILES notation for methyl 2-amino-2,3-dihydropyridine-5-carboxylate?
The canonical SMILES for methyl 2-amino-2,3-dihydropyridine-5-carboxylate is COC(=O)C1=CCC(N)N=C1.
What is the InChIKey of methyl 2-amino-2,3-dihydropyridine-5-carboxylate?
The InChIKey is YMCRURJEODCDCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-11-7(10)5-2-3-6(8)9-4-5/h2,4,6H,3,8H2,1H3.
What are the key properties of methyl 2-amino-2,3-dihydropyridine-5-carboxylate?
methyl 2-amino-2,3-dihydropyridine-5-carboxylate has a molecular weight of 154.17 g/mol, XLogP of -0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-2,3-dihydropyridine-5-carboxylate is sourced from PubChem (CID 90963851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).