About [dimethyl(octyl)silyl] butane-1-sulfonate
[dimethyl(octyl)silyl] butane-1-sulfonate (PubChem CID 90964254) has the molecular formula C14H32O3SSi
and a molecular weight of 308.56 g/mol. Its IUPAC name is [dimethyl(octyl)silyl] butane-1-sulfonate.
Molecular Properties
| Compound Name | [dimethyl(octyl)silyl] butane-1-sulfonate |
| PubChem CID | 90964254 |
| Molecular Formula | C14H32O3SSi |
| Molecular Weight | 308.56 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | [dimethyl(octyl)silyl] butane-1-sulfonate |
| SMILES | CCCCCCCC[Si](C)(C)OS(=O)(=O)CCCC |
| InChI | InChI=1S/C14H32O3SSi/c1-5-7-9-10-11-12-14-19(3,4)17-18(15,16)13-8-6-2/h5-14H2,1-4H3 |
| InChIKey | ILPFCXOINBVRFP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [dimethyl(octyl)silyl] butane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl(octyl)silyl] butane-1-sulfonate?
The IUPAC name of [dimethyl(octyl)silyl] butane-1-sulfonate (CID 90964254) is [dimethyl(octyl)silyl] butane-1-sulfonate.
What is the SMILES notation for [dimethyl(octyl)silyl] butane-1-sulfonate?
The canonical SMILES for [dimethyl(octyl)silyl] butane-1-sulfonate is CCCCCCCC[Si](C)(C)OS(=O)(=O)CCCC.
What is the InChIKey of [dimethyl(octyl)silyl] butane-1-sulfonate?
The InChIKey is ILPFCXOINBVRFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32O3SSi/c1-5-7-9-10-11-12-14-19(3,4)17-18(15,16)13-8-6-2/h5-14H2,1-4H3.
What are the key properties of [dimethyl(octyl)silyl] butane-1-sulfonate?
[dimethyl(octyl)silyl] butane-1-sulfonate has a molecular weight of 308.56 g/mol, XLogP of 4.70, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl(octyl)silyl] butane-1-sulfonate is sourced from PubChem (CID 90964254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).