C30H30F3NO11 — CID 90964344
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[4-(difluoromethoxy)phenyl]-(4-fluoro-1H-indol-3-yl)-hydroxymethyl]oxan-2-yl]methyl acetate (PubChem CID 90964344) has the molecular formula C30H30F3NO11 and a molecular weight of 637.56 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[4-(difluoromethoxy)phenyl]-(4-fluoro-1H-indol-3-yl)-hydroxymethyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[4-(difluoromethoxy)phenyl]-(4-fluoro-1H-indol-3-yl)-hydroxymethyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 90964344 |
| Molecular Formula | C30H30F3NO11 |
| Molecular Weight | 637.56 g/mol |
| Exact Mass | 637.18 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[4-(difluoromethoxy)phenyl]-(4-fluoro-1H-indol-3-yl)-hydroxymethyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](C(O)(c2ccc(OC(F)F)cc2)c2c[nH]c3cccc(F)c23)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C30H30F3NO11/c1-14(35)40-13-23-25(41-15(2)36)26(42-16(3)37)27(43-17(4)38)28(45-23)30(39,18-8-10-19(11-9-18)44-29(32)33)20-12-34-22-7-5-6-21(31)24(20)22/h5-12,23,25-29,34,39H,13H2,1-4H3/t23-,25-,26+,27-,28-,30?/m1/s1 |
| InChIKey | SVQWTBPEINAQEF-MLISQXQESA-N |
| XLogP | 3.27 |
| TPSA | 159.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|