C23H45N2+ — CID 90964855
3-icos-11-en-5-yl-4,5-dihydro-1H-imidazol-3-ium (PubChem CID 90964855) has the molecular formula C23H45N2+ and a molecular weight of 349.63 g/mol. Its IUPAC name is 3-icos-11-en-5-yl-4,5-dihydro-1H-imidazol-3-ium.
| Compound Name | 3-icos-11-en-5-yl-4,5-dihydro-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 90964855 |
| Molecular Formula | C23H45N2+ |
| Molecular Weight | 349.63 g/mol |
| Exact Mass | 349.36 |
| IUPAC Name | 3-icos-11-en-5-yl-4,5-dihydro-1H-imidazol-3-ium |
| SMILES | CCCCCCCCC=CCCCCCC(CCCC)[N+]1=CNCC1 |
| InChI | InChI=1S/C23H44N2/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-19-23(18-6-4-2)25-21-20-24-22-25/h12-13,22-23H,3-11,14-21H2,1-2H3/p+1 |
| InChIKey | KGRZNEPYBQXXRT-UHFFFAOYSA-O |
| XLogP | 6.45 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.63 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|