C21H28O4 — CID 90965160
(8R,9S,10R,13S,14S)-17-hydroxy-6,10,13-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 90965160) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-17-hydroxy-6,10,13-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | (8R,9S,10R,13S,14S)-17-hydroxy-6,10,13-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 90965160 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (8R,9S,10R,13S,14S)-17-hydroxy-6,10,13-trimethyl-3-oxo-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | CC1=C[C@@H]2[C@H](CC[C@@]3(C)[C@H]2CCC3(O)C(=O)O)[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C21H28O4/c1-12-10-14-15(19(2)7-4-13(22)11-17(12)19)5-8-20(3)16(14)6-9-21(20,25)18(23)24/h10-11,14-16,25H,4-9H2,1-3H3,(H,23,24)/t14-,15+,16+,19-,20+,21?/m1/s1 |
| InChIKey | STXFHQFJDIRGFX-YRZJNLSESA-N |
| XLogP | 3.50 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |