About N-ethenyl-N,2-dimethylbutan-1-amine
N-ethenyl-N,2-dimethylbutan-1-amine (PubChem CID 90965303) has the molecular formula C8H17N
and a molecular weight of 127.23 g/mol. Its IUPAC name is N-ethenyl-N,2-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | N-ethenyl-N,2-dimethylbutan-1-amine |
| PubChem CID | 90965303 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | N-ethenyl-N,2-dimethylbutan-1-amine |
| SMILES | C=CN(C)CC(C)CC |
| InChI | InChI=1S/C8H17N/c1-5-8(3)7-9(4)6-2/h6,8H,2,5,7H2,1,3-4H3 |
| InChIKey | XWYJNIOBOHVGCZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethenyl-N,2-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N,2-dimethylbutan-1-amine?
The IUPAC name of N-ethenyl-N,2-dimethylbutan-1-amine (CID 90965303) is N-ethenyl-N,2-dimethylbutan-1-amine.
What is the SMILES notation for N-ethenyl-N,2-dimethylbutan-1-amine?
The canonical SMILES for N-ethenyl-N,2-dimethylbutan-1-amine is C=CN(C)CC(C)CC.
What is the InChIKey of N-ethenyl-N,2-dimethylbutan-1-amine?
The InChIKey is XWYJNIOBOHVGCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N/c1-5-8(3)7-9(4)6-2/h6,8H,2,5,7H2,1,3-4H3.
What are the key properties of N-ethenyl-N,2-dimethylbutan-1-amine?
N-ethenyl-N,2-dimethylbutan-1-amine has a molecular weight of 127.23 g/mol, XLogP of 2.11, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N,2-dimethylbutan-1-amine is sourced from PubChem (CID 90965303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).