C24H28FN3O — CID 90965670
1-(4-fluorophenyl)-N-[(1S,2R,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-2,3-dihydroimidazo[1,5-a]pyridine-3-carboxamide (PubChem CID 90965670) has the molecular formula C24H28FN3O and a molecular weight of 393.51 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[(1S,2R,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-2,3-dihydroimidazo[1,5-a]pyridine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[(1S,2R,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-2,3-dihydroimidazo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90965670 |
| Molecular Formula | C24H28FN3O |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[(1S,2R,4R)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-2,3-dihydroimidazo[1,5-a]pyridine-3-carboxamide |
| SMILES | CC1(C)[C@@H]2CC[C@@](C)(C2)[C@H]1NC(=O)C1NC(c2ccc(F)cc2)=C2C=CC=CN21 |
| InChI | InChI=1S/C24H28FN3O/c1-23(2)16-11-12-24(3,14-16)22(23)27-21(29)20-26-19(15-7-9-17(25)10-8-15)18-6-4-5-13-28(18)20/h4-10,13,16,20,22,26H,11-12,14H2,1-3H3,(H,27,29)/t16-,20?,22+,24+/m1/s1 |
| InChIKey | VPHRWJGHVGTUBB-QSHVLJBJSA-N |
| XLogP | 4.14 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |