C18H18 — CID 90965894
tetracyclo[9.7.0.03,9.012,17]octadeca-1(11),2,9,12,14,16-hexaene (PubChem CID 90965894) has the molecular formula C18H18 and a molecular weight of 234.34 g/mol. Its IUPAC name is tetracyclo[9.7.0.03,9.012,17]octadeca-1(11),2,9,12,14,16-hexaene.
| Compound Name | tetracyclo[9.7.0.03,9.012,17]octadeca-1(11),2,9,12,14,16-hexaene |
|---|---|
| PubChem CID | 90965894 |
| Molecular Formula | C18H18 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | tetracyclo[9.7.0.03,9.012,17]octadeca-1(11),2,9,12,14,16-hexaene |
| SMILES | c1ccc2c(c1)Cc1cc3c(cc1-2)CCCCC3 |
| InChI | InChI=1S/C18H18/c1-2-6-13-10-16-11-15-8-4-5-9-17(15)18(16)12-14(13)7-3-1/h4-5,8-10,12H,1-3,6-7,11H2 |
| InChIKey | AXVWLTJWTPCQLZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |