C30H39N5O3 — CID 90966259
6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-(2-ethyl-6-propan-2-yl-4-pyridinyl)ethyl]oxane-2,4-dione (PubChem CID 90966259) has the molecular formula C30H39N5O3 and a molecular weight of 517.67 g/mol. Its IUPAC name is 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-(2-ethyl-6-propan-2-yl-4-pyridinyl)ethyl]oxane-2,4-dione.
| Compound Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-(2-ethyl-6-propan-2-yl-4-pyridinyl)ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 90966259 |
| Molecular Formula | C30H39N5O3 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | 6-cyclopentyl-3-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-[2-(2-ethyl-6-propan-2-yl-4-pyridinyl)ethyl]oxane-2,4-dione |
| SMILES | CCc1cc(CCC2(C3CCCC3)CC(=O)C(Cc3nc4nc(C)cc(C)n4n3)C(=O)O2)cc(C(C)C)n1 |
| InChI | InChI=1S/C30H39N5O3/c1-6-23-14-21(15-25(32-23)18(2)3)11-12-30(22-9-7-8-10-22)17-26(36)24(28(37)38-30)16-27-33-29-31-19(4)13-20(5)35(29)34-27/h13-15,18,22,24H,6-12,16-17H2,1-5H3 |
| InChIKey | QCDOPPDFPYYCLL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 99.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|