C14H20F4O — CID 90967116
1-ethyl-2,3,5,6-tetrafluoro-4-hex-2-enoxycyclohexene (PubChem CID 90967116) has the molecular formula C14H20F4O and a molecular weight of 280.31 g/mol. Its IUPAC name is 1-ethyl-2,3,5,6-tetrafluoro-4-hex-2-enoxycyclohexene.
| Compound Name | 1-ethyl-2,3,5,6-tetrafluoro-4-hex-2-enoxycyclohexene |
|---|---|
| PubChem CID | 90967116 |
| Molecular Formula | C14H20F4O |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-ethyl-2,3,5,6-tetrafluoro-4-hex-2-enoxycyclohexene |
| SMILES | CCCC=CCOC1C(F)C(F)=C(CC)C(F)C1F |
| InChI | InChI=1S/C14H20F4O/c1-3-5-6-7-8-19-14-12(17)10(15)9(4-2)11(16)13(14)18/h6-7,10,12-14H,3-5,8H2,1-2H3 |
| InChIKey | SPOSUWXIVSSRPC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|