C28H24Cl2O3 — CID 90967200
(1R,5S,6R)-6-(4-chlorophenyl)-3-[5-(4-chlorophenyl)-2-ethylphenyl]-1-methyl-8-oxabicyclo[3.2.1]octane-2,4-dione (PubChem CID 90967200) has the molecular formula C28H24Cl2O3 and a molecular weight of 479.40 g/mol. Its IUPAC name is (1R,5S,6R)-6-(4-chlorophenyl)-3-[5-(4-chlorophenyl)-2-ethylphenyl]-1-methyl-8-oxabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1R,5S,6R)-6-(4-chlorophenyl)-3-[5-(4-chlorophenyl)-2-ethylphenyl]-1-methyl-8-oxabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 90967200 |
| Molecular Formula | C28H24Cl2O3 |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | (1R,5S,6R)-6-(4-chlorophenyl)-3-[5-(4-chlorophenyl)-2-ethylphenyl]-1-methyl-8-oxabicyclo[3.2.1]octane-2,4-dione |
| SMILES | CCc1ccc(-c2ccc(Cl)cc2)cc1C1C(=O)[C@H]2O[C@](C)(C[C@@H]2c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C28H24Cl2O3/c1-3-16-4-5-19(17-6-10-20(29)11-7-17)14-22(16)24-25(31)26-23(15-28(2,33-26)27(24)32)18-8-12-21(30)13-9-18/h4-14,23-24,26H,3,15H2,1-2H3/t23-,24?,26+,28-/m1/s1 |
| InChIKey | FRQKOAZKPNBNRY-VAHUSETISA-N |
| XLogP | 6.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|