C20H24F12O6 — CID 90967300
2-[[3,5-bis[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]cyclohexyl]methyl]prop-2-enoic acid (PubChem CID 90967300) has the molecular formula C20H24F12O6 and a molecular weight of 588.38 g/mol. Its IUPAC name is 2-[[3,5-bis[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]cyclohexyl]methyl]prop-2-enoic acid.
| Compound Name | 2-[[3,5-bis[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]cyclohexyl]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90967300 |
| Molecular Formula | C20H24F12O6 |
| Molecular Weight | 588.38 g/mol |
| Exact Mass | 588.14 |
| IUPAC Name | 2-[[3,5-bis[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]cyclohexyl]methyl]prop-2-enoic acid |
| SMILES | C=C(CC1CC(C(OCOC)(C(F)(F)F)C(F)(F)F)CC(C(OCOC)(C(F)(F)F)C(F)(F)F)C1)C(=O)O |
| InChI | InChI=1S/C20H24F12O6/c1-10(14(33)34)4-11-5-12(15(17(21,22)23,18(24,25)26)37-8-35-2)7-13(6-11)16(19(27,28)29,20(30,31)32)38-9-36-3/h11-13H,1,4-9H2,2-3H3,(H,33,34) |
| InChIKey | AYWYHHSQKGPKJW-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.38 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|