C19H19F3N2O2 — CID 90967646
(7R)-8-propyl-4-[3-(trifluoromethyl)phenyl]-4,8-diazatricyclo[5.2.2.02,6]undeca-2,5,10-triene-3,5-diol (PubChem CID 90967646) has the molecular formula C19H19F3N2O2 and a molecular weight of 364.37 g/mol. Its IUPAC name is (7R)-8-propyl-4-[3-(trifluoromethyl)phenyl]-4,8-diazatricyclo[5.2.2.02,6]undeca-2,5,10-triene-3,5-diol.
| Compound Name | (7R)-8-propyl-4-[3-(trifluoromethyl)phenyl]-4,8-diazatricyclo[5.2.2.02,6]undeca-2,5,10-triene-3,5-diol |
|---|---|
| PubChem CID | 90967646 |
| Molecular Formula | C19H19F3N2O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (7R)-8-propyl-4-[3-(trifluoromethyl)phenyl]-4,8-diazatricyclo[5.2.2.02,6]undeca-2,5,10-triene-3,5-diol |
| SMILES | CCCN1CC2C=C[C@@H]1c1c2c(O)n(-c2cccc(C(F)(F)F)c2)c1O |
| InChI | InChI=1S/C19H19F3N2O2/c1-2-8-23-10-11-6-7-14(23)16-15(11)17(25)24(18(16)26)13-5-3-4-12(9-13)19(20,21)22/h3-7,9,11,14,25-26H,2,8,10H2,1H3/t11?,14-/m1/s1 |
| InChIKey | MVVVKFKXHMNJKH-SBXXRYSUSA-N |
| XLogP | 4.33 |
| TPSA | 48.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|