C30H37FN4O — CID 90967984
1,1-diethyl-3-[2-[5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl]-1-phenylethyl]urea (PubChem CID 90967984) has the molecular formula C30H37FN4O and a molecular weight of 488.65 g/mol. Its IUPAC name is 1,1-diethyl-3-[2-[5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl]-1-phenylethyl]urea.
| Compound Name | 1,1-diethyl-3-[2-[5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl]-1-phenylethyl]urea |
|---|---|
| PubChem CID | 90967984 |
| Molecular Formula | C30H37FN4O |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | 1,1-diethyl-3-[2-[5-(4-fluorophenyl)imino-6-methanimidoyl-7a-methyl-2,3,6,7-tetrahydro-1H-inden-1-yl]-1-phenylethyl]urea |
| SMILES | [H]/N=C/C1CC2(C)C(=C/C1=N\c1ccc(F)cc1)CCC2CC(NC(=O)N(CC)CC)c1ccccc1 |
| InChI | InChI=1S/C30H37FN4O/c1-4-35(5-2)29(36)34-27(21-9-7-6-8-10-21)17-23-11-12-24-18-28(22(20-32)19-30(23,24)3)33-26-15-13-25(31)14-16-26/h6-10,13-16,18,20,22-23,27,32H,4-5,11-12,17,19H2,1-3H3,(H,34,36)/b32-20+,33-28+ |
| InChIKey | MFWGSCFXMOBSOO-RUFBPXDPSA-N |
| XLogP | 7.09 |
| TPSA | 68.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|