About 2-chloroanthracene-1,3,9-triol
2-chloroanthracene-1,3,9-triol (PubChem CID 90968006) has the molecular formula C14H9ClO3
and a molecular weight of 260.68 g/mol. Its IUPAC name is 2-chloroanthracene-1,3,9-triol.
Molecular Properties
| Compound Name | 2-chloroanthracene-1,3,9-triol |
| PubChem CID | 90968006 |
| Molecular Formula | C14H9ClO3 |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 2-chloroanthracene-1,3,9-triol |
| SMILES | Oc1cc2cc3ccccc3c(O)c2c(O)c1Cl |
| InChI | InChI=1S/C14H9ClO3/c15-12-10(16)6-8-5-7-3-1-2-4-9(7)13(17)11(8)14(12)18/h1-6,16-18H |
| InChIKey | AGIDQQPDEMCOLI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroanthracene-1,3,9-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroanthracene-1,3,9-triol?
The IUPAC name of 2-chloroanthracene-1,3,9-triol (CID 90968006) is 2-chloroanthracene-1,3,9-triol.
What is the SMILES notation for 2-chloroanthracene-1,3,9-triol?
The canonical SMILES for 2-chloroanthracene-1,3,9-triol is Oc1cc2cc3ccccc3c(O)c2c(O)c1Cl.
What is the InChIKey of 2-chloroanthracene-1,3,9-triol?
The InChIKey is AGIDQQPDEMCOLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClO3/c15-12-10(16)6-8-5-7-3-1-2-4-9(7)13(17)11(8)14(12)18/h1-6,16-18H.
What are the key properties of 2-chloroanthracene-1,3,9-triol?
2-chloroanthracene-1,3,9-triol has a molecular weight of 260.68 g/mol, XLogP of 3.76, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroanthracene-1,3,9-triol is sourced from PubChem (CID 90968006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).