C28H31F3N3O7PS — CID 90968134
2-[3-[5-(3-cyclopropylsulfonylphenyl)-3-methylpyrido[2,3-b]indol-9-yl]oxypropyl-(2,2,2-trifluoroethyl)amino]ethyl dihydrogen phosphate (PubChem CID 90968134) has the molecular formula C28H31F3N3O7PS and a molecular weight of 641.60 g/mol. Its IUPAC name is 2-[3-[5-(3-cyclopropylsulfonylphenyl)-3-methylpyrido[2,3-b]indol-9-yl]oxypropyl-(2,2,2-trifluoroethyl)amino]ethyl dihydrogen phosphate.
| Compound Name | 2-[3-[5-(3-cyclopropylsulfonylphenyl)-3-methylpyrido[2,3-b]indol-9-yl]oxypropyl-(2,2,2-trifluoroethyl)amino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 90968134 |
| Molecular Formula | C28H31F3N3O7PS |
| Molecular Weight | 641.60 g/mol |
| Exact Mass | 641.16 |
| IUPAC Name | 2-[3-[5-(3-cyclopropylsulfonylphenyl)-3-methylpyrido[2,3-b]indol-9-yl]oxypropyl-(2,2,2-trifluoroethyl)amino]ethyl dihydrogen phosphate |
| SMILES | Cc1cnc2c(c1)c1c(-c3cccc(S(=O)(=O)C4CC4)c3)cccc1n2OCCCN(CCOP(=O)(O)O)CC(F)(F)F |
| InChI | InChI=1S/C28H31F3N3O7PS/c1-19-15-24-26-23(20-5-2-6-22(16-20)43(38,39)21-9-10-21)7-3-8-25(26)34(27(24)32-17-19)40-13-4-11-33(18-28(29,30)31)12-14-41-42(35,36)37/h2-3,5-8,15-17,21H,4,9-14,18H2,1H3,(H2,35,36,37) |
| InChIKey | ASDOCEATCVFSNM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|