About 2-(2-ethylhexyl)-2,3-dihydrothiophene
2-(2-ethylhexyl)-2,3-dihydrothiophene (PubChem CID 90968260) has the molecular formula C12H22S
and a molecular weight of 198.38 g/mol. Its IUPAC name is 2-(2-ethylhexyl)-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 2-(2-ethylhexyl)-2,3-dihydrothiophene |
| PubChem CID | 90968260 |
| Molecular Formula | C12H22S |
| Molecular Weight | 198.38 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 2-(2-ethylhexyl)-2,3-dihydrothiophene |
| SMILES | CCCCC(CC)CC1CC=CS1 |
| InChI | InChI=1S/C12H22S/c1-3-5-7-11(4-2)10-12-8-6-9-13-12/h6,9,11-12H,3-5,7-8,10H2,1-2H3 |
| InChIKey | NFRYYUUHUPCOSV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.38 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-ethylhexyl)-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-ethylhexyl)-2,3-dihydrothiophene?
The IUPAC name of 2-(2-ethylhexyl)-2,3-dihydrothiophene (CID 90968260) is 2-(2-ethylhexyl)-2,3-dihydrothiophene.
What is the SMILES notation for 2-(2-ethylhexyl)-2,3-dihydrothiophene?
The canonical SMILES for 2-(2-ethylhexyl)-2,3-dihydrothiophene is CCCCC(CC)CC1CC=CS1.
What is the InChIKey of 2-(2-ethylhexyl)-2,3-dihydrothiophene?
The InChIKey is NFRYYUUHUPCOSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22S/c1-3-5-7-11(4-2)10-12-8-6-9-13-12/h6,9,11-12H,3-5,7-8,10H2,1-2H3.
What are the key properties of 2-(2-ethylhexyl)-2,3-dihydrothiophene?
2-(2-ethylhexyl)-2,3-dihydrothiophene has a molecular weight of 198.38 g/mol, XLogP of 4.61, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-ethylhexyl)-2,3-dihydrothiophene is sourced from PubChem (CID 90968260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).