C21H40N8O3 — CID 90968332
N-[4,6-bis[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]hydroxylamine (PubChem CID 90968332) has the molecular formula C21H40N8O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is N-[4,6-bis[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]hydroxylamine.
| Compound Name | N-[4,6-bis[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 90968332 |
| Molecular Formula | C21H40N8O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.32 |
| IUPAC Name | N-[4,6-bis[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]hydroxylamine |
| SMILES | CC1(C)CC(Nc2nc(NO)nc(NC3CC(C)(C)N(O)C(C)(C)C3)n2)CC(C)(C)N1O |
| InChI | InChI=1S/C21H40N8O3/c1-18(2)9-13(10-19(3,4)28(18)31)22-15-24-16(26-17(25-15)27-30)23-14-11-20(5,6)29(32)21(7,8)12-14/h13-14,30-32H,9-12H2,1-8H3,(H3,22,23,24,25,26,27) |
| InChIKey | DEZWJIBKVPJVDK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 141.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|