About 2-amino-3-methyl-N-(6-morpholin-4-ylcyclohexa-1,5-dien-1-yl)pentanamide
2-amino-3-methyl-N-(6-morpholin-4-ylcyclohexa-1,5-dien-1-yl)pentanamide (PubChem CID 90968486) has the molecular formula C16H27N3O2
and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-amino-3-methyl-N-(6-morpholin-4-ylcyclohexa-1,5-dien-1-yl)pentanamide.
Molecular Properties
| Compound Name | 2-amino-3-methyl-N-(6-morpholin-4-ylcyclohexa-1,5-dien-1-yl)pentanamide |
| PubChem CID | 90968486 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 2-amino-3-methyl-N-(6-morpholin-4-ylcyclohexa-1,5-dien-1-yl)pentanamide |
| SMILES | CCC(C)C(N)C(=O)NC1=CCCC=C1N1CCOCC1 |
| InChI | InChI=1S/C16H27N3O2/c1-3-12(2)15(17)16(20)18-13-6-4-5-7-14(13)19-8-10-21-11-9-19/h6-7,12,15H,3-5,8-11,17H2,1-2H3,(H,18,20) |
| InChIKey | JUQQGMFGOMMPOV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-3-methyl-N-(6-morpholin-4-ylcyclohexa-1,5-dien-1-yl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-methyl-N-(6-morpholin-4-ylcyclohexa-1,5-dien-1-yl)pentanamide?
The IUPAC name of 2-amino-3-methyl-N-(6-morpholin-4-ylcyclohexa-1,5-dien-1-yl)pentanamide (CID 90968486) is 2-amino-3-methyl-N-(6-morpholin-4-ylcyclohexa-1,5-dien-1-yl)pentanamide.
What is the SMILES notation for 2-amino-3-methyl-N-(6-morpholin-4-ylcyclohexa-1,5-dien-1-yl)pentanamide?
The canonical SMILES for 2-amino-3-methyl-N-(6-morpholin-4-ylcyclohexa-1,5-dien-1-yl)pentanamide is CCC(C)C(N)C(=O)NC1=CCCC=C1N1CCOCC1.
What is the InChIKey of 2-amino-3-methyl-N-(6-morpholin-4-ylcyclohexa-1,5-dien-1-yl)pentanamide?
The InChIKey is JUQQGMFGOMMPOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3O2/c1-3-12(2)15(17)16(20)18-13-6-4-5-7-14(13)19-8-10-21-11-9-19/h6-7,12,15H,3-5,8-11,17H2,1-2H3,(H,18,20).
What are the key properties of 2-amino-3-methyl-N-(6-morpholin-4-ylcyclohexa-1,5-dien-1-yl)pentanamide?
2-amino-3-methyl-N-(6-morpholin-4-ylcyclohexa-1,5-dien-1-yl)pentanamide has a molecular weight of 293.41 g/mol, XLogP of 1.37, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-methyl-N-(6-morpholin-4-ylcyclohexa-1,5-dien-1-yl)pentanamide is sourced from PubChem (CID 90968486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).