C24H33NO7 — CID 90968903
4-[[(3S,10R,13S)-10,13-dimethyl-7,17-dioxo-2,3,6,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]-4-hydroxybutanoic acid (PubChem CID 90968903) has the molecular formula C24H33NO7 and a molecular weight of 447.53 g/mol. Its IUPAC name is 4-[[(3S,10R,13S)-10,13-dimethyl-7,17-dioxo-2,3,6,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]-4-hydroxybutanoic acid.
| Compound Name | 4-[[(3S,10R,13S)-10,13-dimethyl-7,17-dioxo-2,3,6,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 90968903 |
| Molecular Formula | C24H33NO7 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 4-[[(3S,10R,13S)-10,13-dimethyl-7,17-dioxo-2,3,6,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]-4-hydroxybutanoic acid |
| SMILES | C[C@]12CC[C@H](OC(=O)NC(O)CCC(=O)O)C=C1CC(=O)C1C2CC[C@]2(C)C(=O)CCC12 |
| InChI | InChI=1S/C24H33NO7/c1-23-9-7-14(32-22(31)25-19(28)5-6-20(29)30)11-13(23)12-17(26)21-15-3-4-18(27)24(15,2)10-8-16(21)23/h11,14-16,19,21,28H,3-10,12H2,1-2H3,(H,25,31)(H,29,30)/t14-,15?,16?,19?,21?,23-,24-/m0/s1 |
| InChIKey | ZEQLNGWEFVPAJG-QVZNUJRMSA-N |
| XLogP | 2.98 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|