C34H46FNO5 — CID 90968937
4-ethoxy-N-[4-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]butyl]-N-(2-methoxyethyl)benzamide (PubChem CID 90968937) has the molecular formula C34H46FNO5 and a molecular weight of 567.74 g/mol. Its IUPAC name is 4-ethoxy-N-[4-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]butyl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-ethoxy-N-[4-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]butyl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 90968937 |
| Molecular Formula | C34H46FNO5 |
| Molecular Weight | 567.74 g/mol |
| Exact Mass | 567.34 |
| IUPAC Name | 4-ethoxy-N-[4-[(13S)-11-fluoro-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]butyl]-N-(2-methoxyethyl)benzamide |
| SMILES | CCOc1ccc(C(=O)N(CCCCC2Cc3cc(O)ccc3C3C(F)C[C@]4(C)C(O)CCC4C23)CCOC)cc1 |
| InChI | InChI=1S/C34H46FNO5/c1-4-41-26-11-8-22(9-12-26)33(39)36(17-18-40-3)16-6-5-7-23-19-24-20-25(37)10-13-27(24)32-29(35)21-34(2)28(31(23)32)14-15-30(34)38/h8-13,20,23,28-32,37-38H,4-7,14-19,21H2,1-3H3/t23?,28?,29?,30?,31?,32?,34-/m0/s1 |
| InChIKey | HMGLNPQAHYGURV-JGKQIDIGSA-N |
| XLogP | 6.14 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.74 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|