C11H10O — CID 90968947
1,1a-dihydrocyclopropa[a]inden-6-ylmethanol (PubChem CID 90968947) has the molecular formula C11H10O and a molecular weight of 158.20 g/mol. Its IUPAC name is 1,1a-dihydrocyclopropa[a]inden-6-ylmethanol.
| Compound Name | 1,1a-dihydrocyclopropa[a]inden-6-ylmethanol |
|---|---|
| PubChem CID | 90968947 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 1,1a-dihydrocyclopropa[a]inden-6-ylmethanol |
| SMILES | OCC1=C2CC2c2ccccc21 |
| InChI | InChI=1S/C11H10O/c12-6-11-8-4-2-1-3-7(8)9-5-10(9)11/h1-4,9,12H,5-6H2 |
| InChIKey | FRTFQJGDOYJDHV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |