C14H18N2O2 — CID 90969055
5-(3,3,4,4-tetramethyloxetan-2-yl)-1,3-benzoxazol-2-amine (PubChem CID 90969055) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 5-(3,3,4,4-tetramethyloxetan-2-yl)-1,3-benzoxazol-2-amine.
| Compound Name | 5-(3,3,4,4-tetramethyloxetan-2-yl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 90969055 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 5-(3,3,4,4-tetramethyloxetan-2-yl)-1,3-benzoxazol-2-amine |
| SMILES | CC1(C)OC(c2ccc3oc(N)nc3c2)C1(C)C |
| InChI | InChI=1S/C14H18N2O2/c1-13(2)11(18-14(13,3)4)8-5-6-10-9(7-8)16-12(15)17-10/h5-7,11H,1-4H3,(H2,15,16) |
| InChIKey | ZWVHRHDRYIAYQJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |