About (5R)-N,N-dibenzyl-3-(4-propan-2-ylphenyl)-3-azabicyclo[3.1.0]hexan-6-amine
(5R)-N,N-dibenzyl-3-(4-propan-2-ylphenyl)-3-azabicyclo[3.1.0]hexan-6-amine (PubChem CID 90969145) has the molecular formula C28H32N2
and a molecular weight of 396.58 g/mol. Its IUPAC name is (5R)-N,N-dibenzyl-3-(4-propan-2-ylphenyl)-3-azabicyclo[3.1.0]hexan-6-amine.
Molecular Properties
| Compound Name | (5R)-N,N-dibenzyl-3-(4-propan-2-ylphenyl)-3-azabicyclo[3.1.0]hexan-6-amine |
| PubChem CID | 90969145 |
| Molecular Formula | C28H32N2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | (5R)-N,N-dibenzyl-3-(4-propan-2-ylphenyl)-3-azabicyclo[3.1.0]hexan-6-amine |
| SMILES | CC(C)c1ccc(N2CC3C(N(Cc4ccccc4)Cc4ccccc4)[C@H]3C2)cc1 |
| InChI | InChI=1S/C28H32N2/c1-21(2)24-13-15-25(16-14-24)29-19-26-27(20-29)28(26)30(17-22-9-5-3-6-10-22)18-23-11-7-4-8-12-23/h3-16,21,26-28H,17-20H2,1-2H3/t26-,27?,28?/m0/s1 |
| InChIKey | JJKASAQPXFENSN-XWYKLZMASA-N |
| XLogP | 5.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze (5R)-N,N-dibenzyl-3-(4-propan-2-ylphenyl)-3-azabicyclo[3.1.0]hexan-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-N,N-dibenzyl-3-(4-propan-2-ylphenyl)-3-azabicyclo[3.1.0]hexan-6-amine?
The IUPAC name of (5R)-N,N-dibenzyl-3-(4-propan-2-ylphenyl)-3-azabicyclo[3.1.0]hexan-6-amine (CID 90969145) is (5R)-N,N-dibenzyl-3-(4-propan-2-ylphenyl)-3-azabicyclo[3.1.0]hexan-6-amine.
What is the SMILES notation for (5R)-N,N-dibenzyl-3-(4-propan-2-ylphenyl)-3-azabicyclo[3.1.0]hexan-6-amine?
The canonical SMILES for (5R)-N,N-dibenzyl-3-(4-propan-2-ylphenyl)-3-azabicyclo[3.1.0]hexan-6-amine is CC(C)c1ccc(N2CC3C(N(Cc4ccccc4)Cc4ccccc4)[C@H]3C2)cc1.
What is the InChIKey of (5R)-N,N-dibenzyl-3-(4-propan-2-ylphenyl)-3-azabicyclo[3.1.0]hexan-6-amine?
The InChIKey is JJKASAQPXFENSN-XWYKLZMASA-N. The full InChI is InChI=1S/C28H32N2/c1-21(2)24-13-15-25(16-14-24)29-19-26-27(20-29)28(26)30(17-22-9-5-3-6-10-22)18-23-11-7-4-8-12-23/h3-16,21,26-28H,17-20H2,1-2H3/t26-,27?,28?/m0/s1.
What are the key properties of (5R)-N,N-dibenzyl-3-(4-propan-2-ylphenyl)-3-azabicyclo[3.1.0]hexan-6-amine?
(5R)-N,N-dibenzyl-3-(4-propan-2-ylphenyl)-3-azabicyclo[3.1.0]hexan-6-amine has a molecular weight of 396.58 g/mol, XLogP of 5.95, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-N,N-dibenzyl-3-(4-propan-2-ylphenyl)-3-azabicyclo[3.1.0]hexan-6-amine is sourced from PubChem (CID 90969145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).