C34H28FN5O3S — CID 90969181
5-(2-fluoro-4-pyridinyl)-N-[1-[2-(2-methoxyphenyl)ethyl]-5-(phenacylamino)benzimidazol-2-yl]thiophene-2-carboxamide (PubChem CID 90969181) has the molecular formula C34H28FN5O3S and a molecular weight of 605.70 g/mol. Its IUPAC name is 5-(2-fluoro-4-pyridinyl)-N-[1-[2-(2-methoxyphenyl)ethyl]-5-(phenacylamino)benzimidazol-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-(2-fluoro-4-pyridinyl)-N-[1-[2-(2-methoxyphenyl)ethyl]-5-(phenacylamino)benzimidazol-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 90969181 |
| Molecular Formula | C34H28FN5O3S |
| Molecular Weight | 605.70 g/mol |
| Exact Mass | 605.19 |
| IUPAC Name | 5-(2-fluoro-4-pyridinyl)-N-[1-[2-(2-methoxyphenyl)ethyl]-5-(phenacylamino)benzimidazol-2-yl]thiophene-2-carboxamide |
| SMILES | COc1ccccc1CCn1c(NC(=O)c2ccc(-c3ccnc(F)c3)s2)nc2cc(NCC(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C34H28FN5O3S/c1-43-29-10-6-5-9-23(29)16-18-40-27-12-11-25(37-21-28(41)22-7-3-2-4-8-22)20-26(27)38-34(40)39-33(42)31-14-13-30(44-31)24-15-17-36-32(35)19-24/h2-15,17,19-20,37H,16,18,21H2,1H3,(H,38,39,42) |
| InChIKey | KVHUWSJLWNEXTN-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.70 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|