About 6-ethyl-2,6,7-trimethyl-2-[3-(propan-2-ylamino)propyl]octan-1-ol
6-ethyl-2,6,7-trimethyl-2-[3-(propan-2-ylamino)propyl]octan-1-ol (PubChem CID 90969879) has the molecular formula C19H41NO
and a molecular weight of 299.54 g/mol. Its IUPAC name is 6-ethyl-2,6,7-trimethyl-2-[3-(propan-2-ylamino)propyl]octan-1-ol.
Molecular Properties
| Compound Name | 6-ethyl-2,6,7-trimethyl-2-[3-(propan-2-ylamino)propyl]octan-1-ol |
| PubChem CID | 90969879 |
| Molecular Formula | C19H41NO |
| Molecular Weight | 299.54 g/mol |
| Exact Mass | 299.32 |
| IUPAC Name | 6-ethyl-2,6,7-trimethyl-2-[3-(propan-2-ylamino)propyl]octan-1-ol |
| SMILES | CCC(C)(CCCC(C)(CO)CCCNC(C)C)C(C)C |
| InChI | InChI=1S/C19H41NO/c1-8-19(7,16(2)3)13-9-11-18(6,15-21)12-10-14-20-17(4)5/h16-17,20-21H,8-15H2,1-7H3 |
| InChIKey | WYSMQUTUKUIWQD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyl-2,6,7-trimethyl-2-[3-(propan-2-ylamino)propyl]octan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2,6,7-trimethyl-2-[3-(propan-2-ylamino)propyl]octan-1-ol?
The IUPAC name of 6-ethyl-2,6,7-trimethyl-2-[3-(propan-2-ylamino)propyl]octan-1-ol (CID 90969879) is 6-ethyl-2,6,7-trimethyl-2-[3-(propan-2-ylamino)propyl]octan-1-ol.
What is the SMILES notation for 6-ethyl-2,6,7-trimethyl-2-[3-(propan-2-ylamino)propyl]octan-1-ol?
The canonical SMILES for 6-ethyl-2,6,7-trimethyl-2-[3-(propan-2-ylamino)propyl]octan-1-ol is CCC(C)(CCCC(C)(CO)CCCNC(C)C)C(C)C.
What is the InChIKey of 6-ethyl-2,6,7-trimethyl-2-[3-(propan-2-ylamino)propyl]octan-1-ol?
The InChIKey is WYSMQUTUKUIWQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H41NO/c1-8-19(7,16(2)3)13-9-11-18(6,15-21)12-10-14-20-17(4)5/h16-17,20-21H,8-15H2,1-7H3.
What are the key properties of 6-ethyl-2,6,7-trimethyl-2-[3-(propan-2-ylamino)propyl]octan-1-ol?
6-ethyl-2,6,7-trimethyl-2-[3-(propan-2-ylamino)propyl]octan-1-ol has a molecular weight of 299.54 g/mol, XLogP of 5.01, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2,6,7-trimethyl-2-[3-(propan-2-ylamino)propyl]octan-1-ol is sourced from PubChem (CID 90969879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).