C52H101N3 — CID 90969983
1-N,3-dimethyl-1-N-[2-[methyl(2-octadeca-9,12-dienylicosa-11,14-dienyl)amino]ethyl]-3-N-pentan-3-ylbutane-1,3-diamine (PubChem CID 90969983) has the molecular formula C52H101N3 and a molecular weight of 768.40 g/mol. Its IUPAC name is 1-N,3-dimethyl-1-N-[2-[methyl(2-octadeca-9,12-dienylicosa-11,14-dienyl)amino]ethyl]-3-N-pentan-3-ylbutane-1,3-diamine.
| Compound Name | 1-N,3-dimethyl-1-N-[2-[methyl(2-octadeca-9,12-dienylicosa-11,14-dienyl)amino]ethyl]-3-N-pentan-3-ylbutane-1,3-diamine |
|---|---|
| PubChem CID | 90969983 |
| Molecular Formula | C52H101N3 |
| Molecular Weight | 768.40 g/mol |
| Exact Mass | 767.80 |
| IUPAC Name | 1-N,3-dimethyl-1-N-[2-[methyl(2-octadeca-9,12-dienylicosa-11,14-dienyl)amino]ethyl]-3-N-pentan-3-ylbutane-1,3-diamine |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(CCCCCCCCC=CCC=CCCCCC)CN(C)CCN(C)CCC(C)(C)NC(CC)CC |
| InChI | InChI=1S/C52H101N3/c1-9-13-15-17-19-21-23-25-27-29-31-33-35-37-39-41-43-50(44-42-40-38-36-34-32-30-28-26-24-22-20-18-16-14-10-2)49-55(8)48-47-54(7)46-45-52(5,6)53-51(11-3)12-4/h19-22,25-28,50-51,53H,9-18,23-24,29-49H2,1-8H3 |
| InChIKey | OKKXWBJHYRILPW-UHFFFAOYSA-N |
| XLogP | 15.82 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.40 |
| LogP ≤ 5 | 15.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|