C14H21F9N2O6S3 — CID 90970029
1,1,2,2,3,3-hexafluoro-3-[4-(2-methylpropyl)azepan-1-yl]sulfonyl-N-(trifluoromethylsulfonyl)propane-1-sulfonamide (PubChem CID 90970029) has the molecular formula C14H21F9N2O6S3 and a molecular weight of 580.51 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[4-(2-methylpropyl)azepan-1-yl]sulfonyl-N-(trifluoromethylsulfonyl)propane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[4-(2-methylpropyl)azepan-1-yl]sulfonyl-N-(trifluoromethylsulfonyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 90970029 |
| Molecular Formula | C14H21F9N2O6S3 |
| Molecular Weight | 580.51 g/mol |
| Exact Mass | 580.04 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[4-(2-methylpropyl)azepan-1-yl]sulfonyl-N-(trifluoromethylsulfonyl)propane-1-sulfonamide |
| SMILES | CC(C)CC1CCCN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H21F9N2O6S3/c1-9(2)8-10-4-3-6-25(7-5-10)34(30,31)13(19,20)11(15,16)12(17,18)32(26,27)24-33(28,29)14(21,22)23/h9-10,24H,3-8H2,1-2H3 |
| InChIKey | IDXXJIQBDVROQT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|