About 4-butyliminooxolan-2-one
4-butyliminooxolan-2-one (PubChem CID 90970183) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is 4-butyliminooxolan-2-one.
Molecular Properties
| Compound Name | 4-butyliminooxolan-2-one |
| PubChem CID | 90970183 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 4-butyliminooxolan-2-one |
| SMILES | CCCC/N=C1\COC(=O)C1 |
| InChI | InChI=1S/C8H13NO2/c1-2-3-4-9-7-5-8(10)11-6-7/h2-6H2,1H3/b9-7- |
| InChIKey | WZGXLJMIOIHZEO-CLFYSBASSA-N |
| XLogP | 1.17 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-butyliminooxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyliminooxolan-2-one?
The IUPAC name of 4-butyliminooxolan-2-one (CID 90970183) is 4-butyliminooxolan-2-one.
What is the SMILES notation for 4-butyliminooxolan-2-one?
The canonical SMILES for 4-butyliminooxolan-2-one is CCCC/N=C1\COC(=O)C1.
What is the InChIKey of 4-butyliminooxolan-2-one?
The InChIKey is WZGXLJMIOIHZEO-CLFYSBASSA-N. The full InChI is InChI=1S/C8H13NO2/c1-2-3-4-9-7-5-8(10)11-6-7/h2-6H2,1H3/b9-7-.
What are the key properties of 4-butyliminooxolan-2-one?
4-butyliminooxolan-2-one has a molecular weight of 155.20 g/mol, XLogP of 1.17, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyliminooxolan-2-one is sourced from PubChem (CID 90970183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).