C27H27Cl2FN4O2 — CID 90970194
3-[1-[1-(2,6-dichloro-3-fluorophenyl)propoxy]pyrrolo[3,2-b]pyridin-6-yl]-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 90970194) has the molecular formula C27H27Cl2FN4O2 and a molecular weight of 529.44 g/mol. Its IUPAC name is 3-[1-[1-(2,6-dichloro-3-fluorophenyl)propoxy]pyrrolo[3,2-b]pyridin-6-yl]-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 3-[1-[1-(2,6-dichloro-3-fluorophenyl)propoxy]pyrrolo[3,2-b]pyridin-6-yl]-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 90970194 |
| Molecular Formula | C27H27Cl2FN4O2 |
| Molecular Weight | 529.44 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | 3-[1-[1-(2,6-dichloro-3-fluorophenyl)propoxy]pyrrolo[3,2-b]pyridin-6-yl]-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | CCC(On1ccc2ncc(-c3cccc(C(=O)NCCN(C)C)c3)cc21)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C27H27Cl2FN4O2/c1-4-24(25-20(28)8-9-21(30)26(25)29)36-34-12-10-22-23(34)15-19(16-32-22)17-6-5-7-18(14-17)27(35)31-11-13-33(2)3/h5-10,12,14-16,24H,4,11,13H2,1-3H3,(H,31,35) |
| InChIKey | ORFLXKFAXCBIKA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.44 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|