C40H61NO — CID 90970409
1-[10-(1-cyclohexylethenyl)-3,4,6-trimethyl-3,4,5,6,7,8-hexahydrocycloocta[c]pyridin-1-yl]-5-[3-(5-methylhepta-2,5-dienyl)cyclopentyl]pentan-3-one (PubChem CID 90970409) has the molecular formula C40H61NO and a molecular weight of 571.93 g/mol. Its IUPAC name is 1-[10-(1-cyclohexylethenyl)-3,4,6-trimethyl-3,4,5,6,7,8-hexahydrocycloocta[c]pyridin-1-yl]-5-[3-(5-methylhepta-2,5-dienyl)cyclopentyl]pentan-3-one.
| Compound Name | 1-[10-(1-cyclohexylethenyl)-3,4,6-trimethyl-3,4,5,6,7,8-hexahydrocycloocta[c]pyridin-1-yl]-5-[3-(5-methylhepta-2,5-dienyl)cyclopentyl]pentan-3-one |
|---|---|
| PubChem CID | 90970409 |
| Molecular Formula | C40H61NO |
| Molecular Weight | 571.93 g/mol |
| Exact Mass | 571.48 |
| IUPAC Name | 1-[10-(1-cyclohexylethenyl)-3,4,6-trimethyl-3,4,5,6,7,8-hexahydrocycloocta[c]pyridin-1-yl]-5-[3-(5-methylhepta-2,5-dienyl)cyclopentyl]pentan-3-one |
| SMILES | C=C(C1=CCCC(C)CC2=C1C(CCC(=O)CCC1CCC(CC=CCC(C)=CC)C1)=NC(C)C2C)C1CCCCC1 |
| InChI | InChI=1S/C40H61NO/c1-7-28(2)14-11-12-16-33-20-21-34(27-33)22-23-36(42)24-25-39-40-37(31(5)35-17-9-8-10-18-35)19-13-15-29(3)26-38(40)30(4)32(6)41-39/h7,11-12,19,29-30,32-35H,5,8-10,13-18,20-27H2,1-4,6H3 |
| InChIKey | YMZSWYHUHOQOKI-UHFFFAOYSA-N |
| XLogP | 11.49 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.93 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|