C20H25F3O8 — CID 90970725
1,1,1-trifluoropropan-2-yl 6-oxo-3-(2-pentanoyloxyacetyl)oxy-5-oxatricyclo[5.2.1.04,8]decane-7-carboxylate (PubChem CID 90970725) has the molecular formula C20H25F3O8 and a molecular weight of 450.41 g/mol. Its IUPAC name is 1,1,1-trifluoropropan-2-yl 6-oxo-3-(2-pentanoyloxyacetyl)oxy-5-oxatricyclo[5.2.1.04,8]decane-7-carboxylate.
| Compound Name | 1,1,1-trifluoropropan-2-yl 6-oxo-3-(2-pentanoyloxyacetyl)oxy-5-oxatricyclo[5.2.1.04,8]decane-7-carboxylate |
|---|---|
| PubChem CID | 90970725 |
| Molecular Formula | C20H25F3O8 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 1,1,1-trifluoropropan-2-yl 6-oxo-3-(2-pentanoyloxyacetyl)oxy-5-oxatricyclo[5.2.1.04,8]decane-7-carboxylate |
| SMILES | CCCCC(=O)OCC(=O)OC1CC2CC3C1OC(=O)C3(C(=O)OC(C)C(F)(F)F)C2 |
| InChI | InChI=1S/C20H25F3O8/c1-3-4-5-14(24)28-9-15(25)30-13-7-11-6-12-16(13)31-18(27)19(12,8-11)17(26)29-10(2)20(21,22)23/h10-13,16H,3-9H2,1-2H3 |
| InChIKey | OZOYFXCUVIQULU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|