C21H27N3O2 — CID 90970787
1-[(4R,5aR,9aR)-4-(2-ethylphenyl)-3-hydroxy-4,5a,6,7,8,9,9a,10-octahydro-2H-pyrrolo[3,4-c][1,5]benzodiazepin-5-yl]ethanone (PubChem CID 90970787) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-[(4R,5aR,9aR)-4-(2-ethylphenyl)-3-hydroxy-4,5a,6,7,8,9,9a,10-octahydro-2H-pyrrolo[3,4-c][1,5]benzodiazepin-5-yl]ethanone.
| Compound Name | 1-[(4R,5aR,9aR)-4-(2-ethylphenyl)-3-hydroxy-4,5a,6,7,8,9,9a,10-octahydro-2H-pyrrolo[3,4-c][1,5]benzodiazepin-5-yl]ethanone |
|---|---|
| PubChem CID | 90970787 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-[(4R,5aR,9aR)-4-(2-ethylphenyl)-3-hydroxy-4,5a,6,7,8,9,9a,10-octahydro-2H-pyrrolo[3,4-c][1,5]benzodiazepin-5-yl]ethanone |
| SMILES | CCc1ccccc1[C@@H]1c2c(c[nH]c2O)N[C@@H]2CCCC[C@H]2N1C(C)=O |
| InChI | InChI=1S/C21H27N3O2/c1-3-14-8-4-5-9-15(14)20-19-17(12-22-21(19)26)23-16-10-6-7-11-18(16)24(20)13(2)25/h4-5,8-9,12,16,18,20,22-23,26H,3,6-7,10-11H2,1-2H3/t16-,18-,20-/m1/s1 |
| InChIKey | HDCZHJBOKKIDQL-YVWKXTFCSA-N |
| XLogP | 3.96 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |