About [3,5-bis(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate
[3,5-bis(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate (PubChem CID 90971033) has the molecular formula C24H15N3O6
and a molecular weight of 441.40 g/mol. Its IUPAC name is [3,5-bis(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate.
Molecular Properties
| Compound Name | [3,5-bis(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate |
| PubChem CID | 90971033 |
| Molecular Formula | C24H15N3O6 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | [3,5-bis(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate |
| SMILES | O=C(Oc1cc(OC(=O)c2ccncc2)cc(OC(=O)c2ccncc2)c1)c1ccncc1 |
| InChI | InChI=1S/C24H15N3O6/c28-22(16-1-7-25-8-2-16)31-19-13-20(32-23(29)17-3-9-26-10-4-17)15-21(14-19)33-24(30)18-5-11-27-12-6-18/h1-15H |
| InChIKey | DGRPQJPARZFUQW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 117.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3,5-bis(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate?
The IUPAC name of [3,5-bis(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate (CID 90971033) is [3,5-bis(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate.
What is the SMILES notation for [3,5-bis(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate?
The canonical SMILES for [3,5-bis(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate is O=C(Oc1cc(OC(=O)c2ccncc2)cc(OC(=O)c2ccncc2)c1)c1ccncc1.
What is the InChIKey of [3,5-bis(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate?
The InChIKey is DGRPQJPARZFUQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15N3O6/c28-22(16-1-7-25-8-2-16)31-19-13-20(32-23(29)17-3-9-26-10-4-17)15-21(14-19)33-24(30)18-5-11-27-12-6-18/h1-15H.
What are the key properties of [3,5-bis(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate?
[3,5-bis(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate has a molecular weight of 441.40 g/mol, XLogP of 3.53, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(pyridine-4-carbonyloxy)phenyl] pyridine-4-carboxylate is sourced from PubChem (CID 90971033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).