C13H21N — CID 90971199
ethane;4-(2-methylidenebutyl)cyclohexa-2,5-dien-1-imine (PubChem CID 90971199) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is ethane;4-(2-methylidenebutyl)cyclohexa-2,5-dien-1-imine.
| Compound Name | ethane;4-(2-methylidenebutyl)cyclohexa-2,5-dien-1-imine |
|---|---|
| PubChem CID | 90971199 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | ethane;4-(2-methylidenebutyl)cyclohexa-2,5-dien-1-imine |
| SMILES | CC.[H]N=C1C=CC(CC(=C)CC)C=C1 |
| InChI | InChI=1S/C11H15N.C2H6/c1-3-9(2)8-10-4-6-11(12)7-5-10;1-2/h4-7,10,12H,2-3,8H2,1H3;1-2H3/b12-11-; |
| InChIKey | CKDBKWZWIDDOFF-AFEZEDKISA-N |
| XLogP | 4.13 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|