About 2,5-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene
2,5-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene (PubChem CID 90971320) has the molecular formula C7H6N2
and a molecular weight of 118.14 g/mol. Its IUPAC name is 2,5-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene.
Analyze 2,5-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene?
The IUPAC name of 2,5-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene (CID 90971320) is 2,5-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene.
What is the SMILES notation for 2,5-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene?
The canonical SMILES for 2,5-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene is c1cnc2c(n1)C1CC21.
What is the InChIKey of 2,5-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene?
The InChIKey is BEYWABCBCQDIEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2/c1-2-9-7-5-3-4(5)6(7)8-1/h1-2,4-5H,3H2.
What are the key properties of 2,5-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene?
2,5-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene has a molecular weight of 118.14 g/mol, XLogP of 1.06, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diazatricyclo[4.3.0.07,9]nona-1,3,5-triene is sourced from PubChem (CID 90971320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).