About N-tert-butyldeca-2,4-dienamide
N-tert-butyldeca-2,4-dienamide (PubChem CID 90971551) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is N-tert-butyldeca-2,4-dienamide.
Molecular Properties
| Compound Name | N-tert-butyldeca-2,4-dienamide |
| PubChem CID | 90971551 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N-tert-butyldeca-2,4-dienamide |
| SMILES | CCCCCC=CC=CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H25NO/c1-5-6-7-8-9-10-11-12-13(16)15-14(2,3)4/h9-12H,5-8H2,1-4H3,(H,15,16) |
| InChIKey | LALIVSZZJHBWFB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyldeca-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyldeca-2,4-dienamide?
The IUPAC name of N-tert-butyldeca-2,4-dienamide (CID 90971551) is N-tert-butyldeca-2,4-dienamide.
What is the SMILES notation for N-tert-butyldeca-2,4-dienamide?
The canonical SMILES for N-tert-butyldeca-2,4-dienamide is CCCCCC=CC=CC(=O)NC(C)(C)C.
What is the InChIKey of N-tert-butyldeca-2,4-dienamide?
The InChIKey is LALIVSZZJHBWFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO/c1-5-6-7-8-9-10-11-12-13(16)15-14(2,3)4/h9-12H,5-8H2,1-4H3,(H,15,16).
What are the key properties of N-tert-butyldeca-2,4-dienamide?
N-tert-butyldeca-2,4-dienamide has a molecular weight of 223.36 g/mol, XLogP of 3.59, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyldeca-2,4-dienamide is sourced from PubChem (CID 90971551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).