C8H9N3OS — CID 90971579
7-methyl-2-(sulfanylmethyl)-3H-[1,2,4]triazolo[1,5-a]pyridin-5-one (PubChem CID 90971579) has the molecular formula C8H9N3OS and a molecular weight of 195.25 g/mol. Its IUPAC name is 7-methyl-2-(sulfanylmethyl)-3H-[1,2,4]triazolo[1,5-a]pyridin-5-one.
| Compound Name | 7-methyl-2-(sulfanylmethyl)-3H-[1,2,4]triazolo[1,5-a]pyridin-5-one |
|---|---|
| PubChem CID | 90971579 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 7-methyl-2-(sulfanylmethyl)-3H-[1,2,4]triazolo[1,5-a]pyridin-5-one |
| SMILES | Cc1cc(=O)n2[nH]c(CS)nc2c1 |
| InChI | InChI=1S/C8H9N3OS/c1-5-2-7-9-6(4-13)10-11(7)8(12)3-5/h2-3,13H,4H2,1H3,(H,9,10) |
| InChIKey | YVQLFJABRNTOMN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|